diff --git a/src/ooxml/java/org/apache/poi/xslf/usermodel/XSLFSimpleShape.java b/src/ooxml/java/org/apache/poi/xslf/usermodel/XSLFSimpleShape.java index 6f1f199ba0..ce058f15a0 100644 --- a/src/ooxml/java/org/apache/poi/xslf/usermodel/XSLFSimpleShape.java +++ b/src/ooxml/java/org/apache/poi/xslf/usermodel/XSLFSimpleShape.java @@ -1,1090 +1,1090 @@ -/* - * ==================================================================== - * Licensed to the Apache Software Foundation (ASF) under one or more - * contributor license agreements. See the NOTICE file distributed with - * this work for additional information regarding copyright ownership. - * The ASF licenses this file to You under the Apache License, Version 2.0 - * (the "License"); you may not use this file except in compliance with - * the License. You may obtain a copy of the License at - * - * http://www.apache.org/licenses/LICENSE-2.0 - * - * Unless required by applicable law or agreed to in writing, software - * distributed under the License is distributed on an "AS IS" BASIS, - * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. - * See the License for the specific language governing permissions and - * limitations under the License. - * ==================================================================== - */ - -package org.apache.poi.xslf.usermodel; - -import java.awt.Color; -import java.awt.geom.Rectangle2D; - -import javax.xml.stream.XMLStreamException; -import javax.xml.stream.XMLStreamReader; - -import org.apache.poi.openxml4j.opc.PackagePart; -import org.apache.poi.sl.draw.DrawPaint; -import org.apache.poi.sl.draw.geom.CustomGeometry; -import org.apache.poi.sl.draw.geom.Guide; -import org.apache.poi.sl.draw.geom.PresetGeometries; -import org.apache.poi.sl.usermodel.FillStyle; -import org.apache.poi.sl.usermodel.LineDecoration; -import org.apache.poi.sl.usermodel.LineDecoration.DecorationShape; -import org.apache.poi.sl.usermodel.LineDecoration.DecorationSize; -import org.apache.poi.sl.usermodel.PaintStyle; -import org.apache.poi.sl.usermodel.PaintStyle.SolidPaint; -import org.apache.poi.sl.usermodel.Placeholder; -import org.apache.poi.sl.usermodel.ShapeType; -import org.apache.poi.sl.usermodel.SimpleShape; -import org.apache.poi.sl.usermodel.StrokeStyle; -import org.apache.poi.sl.usermodel.StrokeStyle.LineCap; -import org.apache.poi.sl.usermodel.StrokeStyle.LineCompound; -import org.apache.poi.sl.usermodel.StrokeStyle.LineDash; -import org.apache.poi.util.Beta; -import org.apache.poi.util.POILogFactory; -import org.apache.poi.util.POILogger; -import org.apache.poi.util.Units; -import org.apache.poi.xslf.model.PropertyFetcher; -import org.apache.poi.xslf.usermodel.XSLFPropertiesDelegate.XSLFEffectProperties; -import org.apache.poi.xslf.usermodel.XSLFPropertiesDelegate.XSLFFillProperties; -import org.apache.poi.xslf.usermodel.XSLFPropertiesDelegate.XSLFGeometryProperties; -import org.apache.xmlbeans.XmlObject; -import org.openxmlformats.schemas.drawingml.x2006.main.CTBaseStyles; -import org.openxmlformats.schemas.drawingml.x2006.main.CTBlip; -import org.openxmlformats.schemas.drawingml.x2006.main.CTEffectStyleItem; -import org.openxmlformats.schemas.drawingml.x2006.main.CTGeomGuide; -import org.openxmlformats.schemas.drawingml.x2006.main.CTLineEndProperties; -import org.openxmlformats.schemas.drawingml.x2006.main.CTLineProperties; -import org.openxmlformats.schemas.drawingml.x2006.main.CTLineStyleList; -import org.openxmlformats.schemas.drawingml.x2006.main.CTNonVisualDrawingProps; -import org.openxmlformats.schemas.drawingml.x2006.main.CTOuterShadowEffect; -import org.openxmlformats.schemas.drawingml.x2006.main.CTPoint2D; -import org.openxmlformats.schemas.drawingml.x2006.main.CTPositiveSize2D; -import org.openxmlformats.schemas.drawingml.x2006.main.CTPresetGeometry2D; -import org.openxmlformats.schemas.drawingml.x2006.main.CTPresetLineDashProperties; -import org.openxmlformats.schemas.drawingml.x2006.main.CTSchemeColor; -import org.openxmlformats.schemas.drawingml.x2006.main.CTShapeProperties; -import org.openxmlformats.schemas.drawingml.x2006.main.CTShapeStyle; -import org.openxmlformats.schemas.drawingml.x2006.main.CTSolidColorFillProperties; -import org.openxmlformats.schemas.drawingml.x2006.main.CTStyleMatrix; -import org.openxmlformats.schemas.drawingml.x2006.main.CTStyleMatrixReference; -import org.openxmlformats.schemas.drawingml.x2006.main.CTTransform2D; -import org.openxmlformats.schemas.drawingml.x2006.main.STCompoundLine; -import org.openxmlformats.schemas.drawingml.x2006.main.STLineCap; -import org.openxmlformats.schemas.drawingml.x2006.main.STLineEndLength; -import org.openxmlformats.schemas.drawingml.x2006.main.STLineEndType; -import org.openxmlformats.schemas.drawingml.x2006.main.STLineEndWidth; -import org.openxmlformats.schemas.drawingml.x2006.main.STPresetLineDashVal; -import org.openxmlformats.schemas.drawingml.x2006.main.STShapeType; -import org.openxmlformats.schemas.presentationml.x2006.main.CTPlaceholder; - -/** - * Represents a single (non-group) shape in a .pptx slide show - */ -@Beta -public abstract class XSLFSimpleShape extends XSLFShape - implements SimpleShape { - private static CTOuterShadowEffect NO_SHADOW = CTOuterShadowEffect.Factory.newInstance(); - private static final POILogger LOG = POILogFactory.getLogger(XSLFSimpleShape.class); - - /* package */XSLFSimpleShape(XmlObject shape, XSLFSheet sheet) { - super(shape,sheet); - } - - @Override - public void setShapeType(ShapeType type) { - XSLFGeometryProperties gp = XSLFPropertiesDelegate.getGeometryDelegate(getShapeProperties()); - if (gp == null) { - return; - } - if (gp.isSetCustGeom()) { - gp.unsetCustGeom(); - } - CTPresetGeometry2D prst = (gp.isSetPrstGeom()) ? gp.getPrstGeom() : gp.addNewPrstGeom(); - prst.setPrst(STShapeType.Enum.forInt(type.ooxmlId)); - } - - @Override - public ShapeType getShapeType(){ - XSLFGeometryProperties gp = XSLFPropertiesDelegate.getGeometryDelegate(getShapeProperties()); - if (gp != null && gp.isSetPrstGeom()) { - STShapeType.Enum geom = gp.getPrstGeom().getPrst(); - if (geom != null) { - return ShapeType.forId(geom.intValue(), true); - } - } - return null; - } - - protected CTTransform2D getXfrm(boolean create) { - PropertyFetcher fetcher = new PropertyFetcher() { - public boolean fetch(XSLFShape shape) { - XmlObject xo = shape.getShapeProperties(); - if (xo instanceof CTShapeProperties && ((CTShapeProperties)xo).isSetXfrm()) { - setValue(((CTShapeProperties)xo).getXfrm()); - return true; - } - return false; - } - }; - fetchShapeProperty(fetcher); - - CTTransform2D xfrm = fetcher.getValue(); - if (!create || xfrm != null) { - return xfrm; - } else { - XmlObject xo = getShapeProperties(); - if (xo instanceof CTShapeProperties) { - return ((CTShapeProperties)xo).addNewXfrm(); - } else { - // ... group shapes have their own getXfrm() - LOG.log(POILogger.WARN, getClass().toString()+" doesn't have xfrm element."); - return null; - } - } - } - - @Override - public Rectangle2D getAnchor() { - - CTTransform2D xfrm = getXfrm(false); - if (xfrm == null) { - return null; - } - - CTPoint2D off = xfrm.getOff(); - double x = Units.toPoints(off.getX()); - double y = Units.toPoints(off.getY()); - CTPositiveSize2D ext = xfrm.getExt(); - double cx = Units.toPoints(ext.getCx()); - double cy = Units.toPoints(ext.getCy()); - return new Rectangle2D.Double(x, y, cx, cy); - } - - @Override - public void setAnchor(Rectangle2D anchor) { - CTTransform2D xfrm = getXfrm(true); - if (xfrm == null) { - return; - } - CTPoint2D off = xfrm.isSetOff() ? xfrm.getOff() : xfrm.addNewOff(); - long x = Units.toEMU(anchor.getX()); - long y = Units.toEMU(anchor.getY()); - off.setX(x); - off.setY(y); - CTPositiveSize2D ext = xfrm.isSetExt() ? xfrm.getExt() : xfrm - .addNewExt(); - long cx = Units.toEMU(anchor.getWidth()); - long cy = Units.toEMU(anchor.getHeight()); - ext.setCx(cx); - ext.setCy(cy); - } - - @Override - public void setRotation(double theta) { - CTTransform2D xfrm = getXfrm(true); - if (xfrm != null) { - xfrm.setRot((int) (theta * 60000)); - } - } - - @Override - public double getRotation() { - CTTransform2D xfrm = getXfrm(false); - return (xfrm == null || !xfrm.isSetRot()) ? 0 : (xfrm.getRot() / 60000.d); - } - - @Override - public void setFlipHorizontal(boolean flip) { - CTTransform2D xfrm = getXfrm(true); - if (xfrm != null) { - xfrm.setFlipH(flip); - } - } - - @Override - public void setFlipVertical(boolean flip) { - CTTransform2D xfrm = getXfrm(true); - if (xfrm != null) { - xfrm.setFlipV(flip); - } - } - - @Override - public boolean getFlipHorizontal() { - CTTransform2D xfrm = getXfrm(false); - return (xfrm == null || !xfrm.isSetFlipH()) ? false : xfrm.getFlipH(); - } - - @Override - public boolean getFlipVertical() { - CTTransform2D xfrm = getXfrm(false); - return (xfrm == null || !xfrm.isSetFlipV()) ? false : xfrm.getFlipV(); - } - - - /** - * Get default line properties defined in the theme (if any). - * Used internally to resolve shape properties. - * - * @return line properties from the theme of null - */ - CTLineProperties getDefaultLineProperties() { - CTShapeStyle style = getSpStyle(); - if (style == null) return null; - CTStyleMatrixReference lnRef = style.getLnRef(); - if (lnRef == null) return null; - // 1-based index of a line style within the style matrix - int idx = (int)lnRef.getIdx(); - - XSLFTheme theme = getSheet().getTheme(); - if (theme == null) return null; - CTBaseStyles styles = theme.getXmlObject().getThemeElements(); - if (styles == null) return null; - CTStyleMatrix styleMatrix = styles.getFmtScheme(); - if (styleMatrix == null) return null; - CTLineStyleList lineStyles = styleMatrix.getLnStyleLst(); - if (lineStyles == null || lineStyles.sizeOfLnArray() < idx) return null; - - return lineStyles.getLnArray(idx - 1); - } - - /** - * @param color the color to paint the shape outline. - * A null value turns off the shape outline. - */ - public void setLineColor(Color color) { - CTLineProperties ln = getLn(this, true); - if (ln == null) { - return; - } - - if (ln.isSetSolidFill()) { - ln.unsetSolidFill(); - } - if (ln.isSetGradFill()) { - ln.unsetGradFill(); - } - if (ln.isSetPattFill()) { - ln.unsetPattFill(); - } - if (ln.isSetNoFill()) { - ln.unsetNoFill(); - } - - - if (color == null) { - ln.addNewNoFill(); - } else { - CTSolidColorFillProperties fill = ln.addNewSolidFill(); - XSLFColor col = new XSLFColor(fill, getSheet().getTheme(), fill.getSchemeClr()); - col.setColor(color); - } - } - - /** - * - * @return the color of the shape outline or null - * if outline is turned off - */ - public Color getLineColor() { - PaintStyle ps = getLinePaint(); - if (ps instanceof SolidPaint) { - return ((SolidPaint)ps).getSolidColor().getColor(); - } - return null; - } - - protected PaintStyle getLinePaint() { - XSLFSheet sheet = getSheet(); - final XSLFTheme theme = sheet.getTheme(); - PropertyFetcher fetcher = new PropertyFetcher() { - public boolean fetch(XSLFShape shape) { - CTLineProperties spPr = getLn(shape, false); - XSLFFillProperties fp = XSLFPropertiesDelegate.getFillDelegate(spPr); - PackagePart pp = shape.getSheet().getPackagePart(); - PaintStyle paint = selectPaint(fp, null, pp, theme); - if (paint != null) { - setValue(paint); - return true; - } - - CTShapeStyle style = shape.getSpStyle(); - if (style != null) { - fp = XSLFPropertiesDelegate.getFillDelegate(style.getLnRef()); - paint = selectPaint(fp, null, pp, theme); - } - if (paint != null) { - setValue(paint); - return true; - } - return false; - } - }; - fetchShapeProperty(fetcher); - - PaintStyle paint = fetcher.getValue(); - if (paint != null) return paint; - - // line color was not found, check if it is defined in the theme - CTShapeStyle style = getSpStyle(); - if (style == null) return null; - - // get a reference to a line style within the style matrix. - CTStyleMatrixReference lnRef = style.getLnRef(); - int idx = (int)lnRef.getIdx(); - CTSchemeColor phClr = lnRef.getSchemeClr(); - if(idx > 0){ - CTLineProperties props = theme.getXmlObject().getThemeElements().getFmtScheme().getLnStyleLst().getLnArray(idx - 1); - XSLFFillProperties fp = XSLFPropertiesDelegate.getFillDelegate(props); - PackagePart pp = sheet.getPackagePart(); - paint = selectPaint(fp, phClr, pp, theme); - } - - return paint; - } - - /** - * - * @param width line width in points. 0 means no line - */ - public void setLineWidth(double width) { - CTLineProperties lnPr = getLn(this, true); - if (lnPr == null) { - return; - } - - if (width == 0.) { - if (lnPr.isSetW()) { - lnPr.unsetW(); - } - if (!lnPr.isSetNoFill()) { - lnPr.addNewNoFill(); - } - if (lnPr.isSetSolidFill()) { - lnPr.unsetSolidFill(); - } - if (lnPr.isSetGradFill()) { - lnPr.unsetGradFill(); - } - if (lnPr.isSetPattFill()) { - lnPr.unsetPattFill(); - } - } else { - if (lnPr.isSetNoFill()) { - lnPr.unsetNoFill(); - } - - lnPr.setW(Units.toEMU(width)); - } - } - - /** - * @return line width in points. 0 means no line. - */ - public double getLineWidth() { - PropertyFetcher fetcher = new PropertyFetcher() { - public boolean fetch(XSLFShape shape) { - CTLineProperties ln = getLn(shape, false); - if (ln != null) { - if (ln.isSetNoFill()) { - setValue(0.); - return true; - } - - if (ln.isSetW()) { - setValue(Units.toPoints(ln.getW())); - return true; - } - } - return false; - } - }; - fetchShapeProperty(fetcher); - - double lineWidth = 0; - if (fetcher.getValue() == null) { - CTLineProperties defaultLn = getDefaultLineProperties(); - if (defaultLn != null) { - if (defaultLn.isSetW()) lineWidth = Units.toPoints(defaultLn.getW()); - } - } else { - lineWidth = fetcher.getValue(); - } - - return lineWidth; - } - - - /** - * @param compound set the line compound style - */ - public void setLineCompound(LineCompound compound) { - CTLineProperties ln = getLn(this, true); - if (ln == null) { - return; - } - if (compound == null) { - if (ln.isSetCmpd()) { - ln.unsetCmpd(); - } - } else { - STCompoundLine.Enum xCmpd; - switch (compound) { - default: - case SINGLE: - xCmpd = STCompoundLine.SNG; - break; - case DOUBLE: - xCmpd = STCompoundLine.DBL; - break; - case THICK_THIN: - xCmpd = STCompoundLine.THICK_THIN; - break; - case THIN_THICK: - xCmpd = STCompoundLine.THIN_THICK; - break; - case TRIPLE: - xCmpd = STCompoundLine.TRI; - break; - } - ln.setCmpd(xCmpd); - } - } - - /** - * @return the line compound - */ - public LineCompound getLineCompound() { - PropertyFetcher fetcher = new PropertyFetcher() { - public boolean fetch(XSLFShape shape) { - CTLineProperties ln = getLn(shape, false); - if (ln != null) { - STCompoundLine.Enum stCmpd = ln.getCmpd(); - if (stCmpd != null) { - setValue(stCmpd.intValue()); - return true; - } - } - return false; - } - }; - fetchShapeProperty(fetcher); - - Integer cmpd = fetcher.getValue(); - if (cmpd == null) { - CTLineProperties defaultLn = getDefaultLineProperties(); - if (defaultLn != null && defaultLn.isSetCmpd()) { - switch (defaultLn.getCmpd().intValue()) { - default: - case STCompoundLine.INT_SNG: - return LineCompound.SINGLE; - case STCompoundLine.INT_DBL: - return LineCompound.DOUBLE; - case STCompoundLine.INT_THICK_THIN: - return LineCompound.THICK_THIN; - case STCompoundLine.INT_THIN_THICK: - return LineCompound.THIN_THICK; - case STCompoundLine.INT_TRI: - return LineCompound.TRIPLE; - } - } - } - - return null; - } - - /** - * - * @param dash a preset line dashing scheme to stroke thr shape outline - */ - public void setLineDash(LineDash dash) { - CTLineProperties ln = getLn(this, true); - if (ln == null) { - return; - } - if (dash == null) { - if (ln.isSetPrstDash()) { - ln.unsetPrstDash(); - } - } else { - CTPresetLineDashProperties ldp = ln.isSetPrstDash() ? ln.getPrstDash() : ln.addNewPrstDash(); - ldp.setVal(STPresetLineDashVal.Enum.forInt(dash.ooxmlId)); - } - } - - /** - * @return a preset line dashing scheme to stroke the shape outline - */ - public LineDash getLineDash() { - - PropertyFetcher fetcher = new PropertyFetcher() { - public boolean fetch(XSLFShape shape) { - CTLineProperties ln = getLn(shape, false); - if (ln == null || !ln.isSetPrstDash()) { - return false; - } - - setValue(LineDash.fromOoxmlId(ln.getPrstDash().getVal().intValue())); - return true; - } - }; - fetchShapeProperty(fetcher); - - LineDash dash = fetcher.getValue(); - if (dash == null) { - CTLineProperties defaultLn = getDefaultLineProperties(); - if (defaultLn != null && defaultLn.isSetPrstDash()) { - dash = LineDash.fromOoxmlId(defaultLn.getPrstDash().getVal().intValue()); - } - } - return dash; - } - - /** - * - * @param cap the line end cap style - */ - public void setLineCap(LineCap cap) { - CTLineProperties ln = getLn(this, true); - if (ln == null) { - return; - } - - if (cap == null) { - if (ln.isSetCap()) { - ln.unsetCap(); - } - } else { - ln.setCap(STLineCap.Enum.forInt(cap.ooxmlId)); - } - } - - /** - * - * @return the line end cap style - */ - public LineCap getLineCap() { - PropertyFetcher fetcher = new PropertyFetcher() { - public boolean fetch(XSLFShape shape) { - CTLineProperties ln = getLn(shape, false); - if (ln != null && ln.isSetCap()) { - setValue(LineCap.fromOoxmlId(ln.getCap().intValue())); - return true; - } - return false; - } - }; - fetchShapeProperty(fetcher); - - LineCap cap = fetcher.getValue(); - if (cap == null) { - CTLineProperties defaultLn = getDefaultLineProperties(); - if (defaultLn != null && defaultLn.isSetCap()) { - cap = LineCap.fromOoxmlId(defaultLn.getCap().intValue()); - } - } - return cap; - } - - @Override - public void setFillColor(Color color) { - XSLFFillProperties fp = XSLFPropertiesDelegate.getFillDelegate(getShapeProperties()); - if (fp == null) { - return; - } - if (color == null) { - if (fp.isSetSolidFill()) { - fp.unsetSolidFill(); - } - - if (fp.isSetGradFill()) { - fp.unsetGradFill(); - } - - if (fp.isSetPattFill()) { - fp.unsetGradFill(); - } - - if (fp.isSetBlipFill()) { - fp.unsetBlipFill(); - } - - if (!fp.isSetNoFill()) { - fp.addNewNoFill(); - } - } else { - if (fp.isSetNoFill()) { - fp.unsetNoFill(); - } - - CTSolidColorFillProperties fill = fp.isSetSolidFill() ? fp.getSolidFill() : fp.addNewSolidFill(); - - XSLFColor col = new XSLFColor(fill, getSheet().getTheme(), fill.getSchemeClr()); - col.setColor(color); - } - } - - @Override - public Color getFillColor() { - PaintStyle ps = getFillPaint(); - if (ps instanceof SolidPaint) { - return DrawPaint.applyColorTransform(((SolidPaint)ps).getSolidColor()); - } - return null; - } - - /** - * @return shadow of this shape or null if shadow is disabled - */ - public XSLFShadow getShadow() { - PropertyFetcher fetcher = new PropertyFetcher() { - public boolean fetch(XSLFShape shape) { - XSLFEffectProperties ep = XSLFPropertiesDelegate.getEffectDelegate(shape.getShapeProperties()); - if (ep != null && ep.isSetEffectLst()) { - CTOuterShadowEffect obj = ep.getEffectLst().getOuterShdw(); - setValue(obj == null ? NO_SHADOW : obj); - return true; - } - return false; - } - }; - fetchShapeProperty(fetcher); - - CTOuterShadowEffect obj = fetcher.getValue(); - if (obj == null) { - // fill color was not found, check if it is defined in the theme - CTShapeStyle style = getSpStyle(); - if (style != null && style.getEffectRef() != null) { - // 1-based index of a shadow style within the style matrix - int idx = (int) style.getEffectRef().getIdx(); - if(idx != 0) { - CTStyleMatrix styleMatrix = getSheet().getTheme().getXmlObject().getThemeElements().getFmtScheme(); - CTEffectStyleItem ef = styleMatrix.getEffectStyleLst().getEffectStyleArray(idx - 1); - obj = ef.getEffectLst().getOuterShdw(); - } - } - } - return (obj == null || obj == NO_SHADOW) ? null : new XSLFShadow(obj, this); - } - - /** - * - * @return definition of the shape geometry - */ - public CustomGeometry getGeometry() { - XSLFGeometryProperties gp = XSLFPropertiesDelegate.getGeometryDelegate(getShapeProperties()); - - if (gp == null) { - return null; - } - - CustomGeometry geom; - PresetGeometries dict = PresetGeometries.getInstance(); - if(gp.isSetPrstGeom()){ - String name = gp.getPrstGeom().getPrst().toString(); - geom = dict.get(name); - if(geom == null) { - throw new IllegalStateException("Unknown shape geometry: " + name + ", available geometries are: " + dict.keySet()); - } - } else if (gp.isSetCustGeom()){ - XMLStreamReader staxReader = gp.getCustGeom().newXMLStreamReader(); - geom = PresetGeometries.convertCustomGeometry(staxReader); +/* + * ==================================================================== + * Licensed to the Apache Software Foundation (ASF) under one or more + * contributor license agreements. See the NOTICE file distributed with + * this work for additional information regarding copyright ownership. + * The ASF licenses this file to You under the Apache License, Version 2.0 + * (the "License"); you may not use this file except in compliance with + * the License. You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + * ==================================================================== + */ + +package org.apache.poi.xslf.usermodel; + +import java.awt.Color; +import java.awt.geom.Rectangle2D; + +import javax.xml.stream.XMLStreamException; +import javax.xml.stream.XMLStreamReader; + +import org.apache.poi.openxml4j.opc.PackagePart; +import org.apache.poi.sl.draw.DrawPaint; +import org.apache.poi.sl.draw.geom.CustomGeometry; +import org.apache.poi.sl.draw.geom.Guide; +import org.apache.poi.sl.draw.geom.PresetGeometries; +import org.apache.poi.sl.usermodel.FillStyle; +import org.apache.poi.sl.usermodel.LineDecoration; +import org.apache.poi.sl.usermodel.LineDecoration.DecorationShape; +import org.apache.poi.sl.usermodel.LineDecoration.DecorationSize; +import org.apache.poi.sl.usermodel.PaintStyle; +import org.apache.poi.sl.usermodel.PaintStyle.SolidPaint; +import org.apache.poi.sl.usermodel.Placeholder; +import org.apache.poi.sl.usermodel.ShapeType; +import org.apache.poi.sl.usermodel.SimpleShape; +import org.apache.poi.sl.usermodel.StrokeStyle; +import org.apache.poi.sl.usermodel.StrokeStyle.LineCap; +import org.apache.poi.sl.usermodel.StrokeStyle.LineCompound; +import org.apache.poi.sl.usermodel.StrokeStyle.LineDash; +import org.apache.poi.util.Beta; +import org.apache.poi.util.POILogFactory; +import org.apache.poi.util.POILogger; +import org.apache.poi.util.Units; +import org.apache.poi.xslf.model.PropertyFetcher; +import org.apache.poi.xslf.usermodel.XSLFPropertiesDelegate.XSLFEffectProperties; +import org.apache.poi.xslf.usermodel.XSLFPropertiesDelegate.XSLFFillProperties; +import org.apache.poi.xslf.usermodel.XSLFPropertiesDelegate.XSLFGeometryProperties; +import org.apache.xmlbeans.XmlObject; +import org.openxmlformats.schemas.drawingml.x2006.main.CTBaseStyles; +import org.openxmlformats.schemas.drawingml.x2006.main.CTBlip; +import org.openxmlformats.schemas.drawingml.x2006.main.CTEffectStyleItem; +import org.openxmlformats.schemas.drawingml.x2006.main.CTGeomGuide; +import org.openxmlformats.schemas.drawingml.x2006.main.CTLineEndProperties; +import org.openxmlformats.schemas.drawingml.x2006.main.CTLineProperties; +import org.openxmlformats.schemas.drawingml.x2006.main.CTLineStyleList; +import org.openxmlformats.schemas.drawingml.x2006.main.CTNonVisualDrawingProps; +import org.openxmlformats.schemas.drawingml.x2006.main.CTOuterShadowEffect; +import org.openxmlformats.schemas.drawingml.x2006.main.CTPoint2D; +import org.openxmlformats.schemas.drawingml.x2006.main.CTPositiveSize2D; +import org.openxmlformats.schemas.drawingml.x2006.main.CTPresetGeometry2D; +import org.openxmlformats.schemas.drawingml.x2006.main.CTPresetLineDashProperties; +import org.openxmlformats.schemas.drawingml.x2006.main.CTSchemeColor; +import org.openxmlformats.schemas.drawingml.x2006.main.CTShapeProperties; +import org.openxmlformats.schemas.drawingml.x2006.main.CTShapeStyle; +import org.openxmlformats.schemas.drawingml.x2006.main.CTSolidColorFillProperties; +import org.openxmlformats.schemas.drawingml.x2006.main.CTStyleMatrix; +import org.openxmlformats.schemas.drawingml.x2006.main.CTStyleMatrixReference; +import org.openxmlformats.schemas.drawingml.x2006.main.CTTransform2D; +import org.openxmlformats.schemas.drawingml.x2006.main.STCompoundLine; +import org.openxmlformats.schemas.drawingml.x2006.main.STLineCap; +import org.openxmlformats.schemas.drawingml.x2006.main.STLineEndLength; +import org.openxmlformats.schemas.drawingml.x2006.main.STLineEndType; +import org.openxmlformats.schemas.drawingml.x2006.main.STLineEndWidth; +import org.openxmlformats.schemas.drawingml.x2006.main.STPresetLineDashVal; +import org.openxmlformats.schemas.drawingml.x2006.main.STShapeType; +import org.openxmlformats.schemas.presentationml.x2006.main.CTPlaceholder; + +/** + * Represents a single (non-group) shape in a .pptx slide show + */ +@Beta +public abstract class XSLFSimpleShape extends XSLFShape + implements SimpleShape { + private static CTOuterShadowEffect NO_SHADOW = CTOuterShadowEffect.Factory.newInstance(); + private static final POILogger LOG = POILogFactory.getLogger(XSLFSimpleShape.class); + + /* package */XSLFSimpleShape(XmlObject shape, XSLFSheet sheet) { + super(shape,sheet); + } + + @Override + public void setShapeType(ShapeType type) { + XSLFGeometryProperties gp = XSLFPropertiesDelegate.getGeometryDelegate(getShapeProperties()); + if (gp == null) { + return; + } + if (gp.isSetCustGeom()) { + gp.unsetCustGeom(); + } + CTPresetGeometry2D prst = (gp.isSetPrstGeom()) ? gp.getPrstGeom() : gp.addNewPrstGeom(); + prst.setPrst(STShapeType.Enum.forInt(type.ooxmlId)); + } + + @Override + public ShapeType getShapeType(){ + XSLFGeometryProperties gp = XSLFPropertiesDelegate.getGeometryDelegate(getShapeProperties()); + if (gp != null && gp.isSetPrstGeom()) { + STShapeType.Enum geom = gp.getPrstGeom().getPrst(); + if (geom != null) { + return ShapeType.forId(geom.intValue(), true); + } + } + return null; + } + + protected CTTransform2D getXfrm(boolean create) { + PropertyFetcher fetcher = new PropertyFetcher() { + public boolean fetch(XSLFShape shape) { + XmlObject xo = shape.getShapeProperties(); + if (xo instanceof CTShapeProperties && ((CTShapeProperties)xo).isSetXfrm()) { + setValue(((CTShapeProperties)xo).getXfrm()); + return true; + } + return false; + } + }; + fetchShapeProperty(fetcher); + + CTTransform2D xfrm = fetcher.getValue(); + if (!create || xfrm != null) { + return xfrm; + } else { + XmlObject xo = getShapeProperties(); + if (xo instanceof CTShapeProperties) { + return ((CTShapeProperties)xo).addNewXfrm(); + } else { + // ... group shapes have their own getXfrm() + LOG.log(POILogger.WARN, getClass().toString()+" doesn't have xfrm element."); + return null; + } + } + } + + @Override + public Rectangle2D getAnchor() { + + CTTransform2D xfrm = getXfrm(false); + if (xfrm == null) { + return null; + } + + CTPoint2D off = xfrm.getOff(); + double x = Units.toPoints(off.getX()); + double y = Units.toPoints(off.getY()); + CTPositiveSize2D ext = xfrm.getExt(); + double cx = Units.toPoints(ext.getCx()); + double cy = Units.toPoints(ext.getCy()); + return new Rectangle2D.Double(x, y, cx, cy); + } + + @Override + public void setAnchor(Rectangle2D anchor) { + CTTransform2D xfrm = getXfrm(true); + if (xfrm == null) { + return; + } + CTPoint2D off = xfrm.isSetOff() ? xfrm.getOff() : xfrm.addNewOff(); + long x = Units.toEMU(anchor.getX()); + long y = Units.toEMU(anchor.getY()); + off.setX(x); + off.setY(y); + CTPositiveSize2D ext = xfrm.isSetExt() ? xfrm.getExt() : xfrm + .addNewExt(); + long cx = Units.toEMU(anchor.getWidth()); + long cy = Units.toEMU(anchor.getHeight()); + ext.setCx(cx); + ext.setCy(cy); + } + + @Override + public void setRotation(double theta) { + CTTransform2D xfrm = getXfrm(true); + if (xfrm != null) { + xfrm.setRot((int) (theta * 60000)); + } + } + + @Override + public double getRotation() { + CTTransform2D xfrm = getXfrm(false); + return (xfrm == null || !xfrm.isSetRot()) ? 0 : (xfrm.getRot() / 60000.d); + } + + @Override + public void setFlipHorizontal(boolean flip) { + CTTransform2D xfrm = getXfrm(true); + if (xfrm != null) { + xfrm.setFlipH(flip); + } + } + + @Override + public void setFlipVertical(boolean flip) { + CTTransform2D xfrm = getXfrm(true); + if (xfrm != null) { + xfrm.setFlipV(flip); + } + } + + @Override + public boolean getFlipHorizontal() { + CTTransform2D xfrm = getXfrm(false); + return (xfrm == null || !xfrm.isSetFlipH()) ? false : xfrm.getFlipH(); + } + + @Override + public boolean getFlipVertical() { + CTTransform2D xfrm = getXfrm(false); + return (xfrm == null || !xfrm.isSetFlipV()) ? false : xfrm.getFlipV(); + } + + + /** + * Get default line properties defined in the theme (if any). + * Used internally to resolve shape properties. + * + * @return line properties from the theme of null + */ + CTLineProperties getDefaultLineProperties() { + CTShapeStyle style = getSpStyle(); + if (style == null) return null; + CTStyleMatrixReference lnRef = style.getLnRef(); + if (lnRef == null) return null; + // 1-based index of a line style within the style matrix + int idx = (int)lnRef.getIdx(); + + XSLFTheme theme = getSheet().getTheme(); + if (theme == null) return null; + CTBaseStyles styles = theme.getXmlObject().getThemeElements(); + if (styles == null) return null; + CTStyleMatrix styleMatrix = styles.getFmtScheme(); + if (styleMatrix == null) return null; + CTLineStyleList lineStyles = styleMatrix.getLnStyleLst(); + if (lineStyles == null || lineStyles.sizeOfLnArray() < idx) return null; + + return lineStyles.getLnArray(idx - 1); + } + + /** + * @param color the color to paint the shape outline. + * A null value turns off the shape outline. + */ + public void setLineColor(Color color) { + CTLineProperties ln = getLn(this, true); + if (ln == null) { + return; + } + + if (ln.isSetSolidFill()) { + ln.unsetSolidFill(); + } + if (ln.isSetGradFill()) { + ln.unsetGradFill(); + } + if (ln.isSetPattFill()) { + ln.unsetPattFill(); + } + if (ln.isSetNoFill()) { + ln.unsetNoFill(); + } + + + if (color == null) { + ln.addNewNoFill(); + } else { + CTSolidColorFillProperties fill = ln.addNewSolidFill(); + XSLFColor col = new XSLFColor(fill, getSheet().getTheme(), fill.getSchemeClr()); + col.setColor(color); + } + } + + /** + * + * @return the color of the shape outline or null + * if outline is turned off + */ + public Color getLineColor() { + PaintStyle ps = getLinePaint(); + if (ps instanceof SolidPaint) { + return ((SolidPaint)ps).getSolidColor().getColor(); + } + return null; + } + + protected PaintStyle getLinePaint() { + XSLFSheet sheet = getSheet(); + final XSLFTheme theme = sheet.getTheme(); + PropertyFetcher fetcher = new PropertyFetcher() { + public boolean fetch(XSLFShape shape) { + CTLineProperties spPr = getLn(shape, false); + XSLFFillProperties fp = XSLFPropertiesDelegate.getFillDelegate(spPr); + PackagePart pp = shape.getSheet().getPackagePart(); + PaintStyle paint = selectPaint(fp, null, pp, theme); + if (paint != null) { + setValue(paint); + return true; + } + + CTShapeStyle style = shape.getSpStyle(); + if (style != null) { + fp = XSLFPropertiesDelegate.getFillDelegate(style.getLnRef()); + paint = selectPaint(fp, null, pp, theme); + } + if (paint != null) { + setValue(paint); + return true; + } + return false; + } + }; + fetchShapeProperty(fetcher); + + PaintStyle paint = fetcher.getValue(); + if (paint != null) return paint; + + // line color was not found, check if it is defined in the theme + CTShapeStyle style = getSpStyle(); + if (style == null) return null; + + // get a reference to a line style within the style matrix. + CTStyleMatrixReference lnRef = style.getLnRef(); + int idx = (int)lnRef.getIdx(); + CTSchemeColor phClr = lnRef.getSchemeClr(); + if(idx > 0){ + CTLineProperties props = theme.getXmlObject().getThemeElements().getFmtScheme().getLnStyleLst().getLnArray(idx - 1); + XSLFFillProperties fp = XSLFPropertiesDelegate.getFillDelegate(props); + PackagePart pp = sheet.getPackagePart(); + paint = selectPaint(fp, phClr, pp, theme); + } + + return paint; + } + + /** + * + * @param width line width in points. 0 means no line + */ + public void setLineWidth(double width) { + CTLineProperties lnPr = getLn(this, true); + if (lnPr == null) { + return; + } + + if (width == 0.) { + if (lnPr.isSetW()) { + lnPr.unsetW(); + } + if (!lnPr.isSetNoFill()) { + lnPr.addNewNoFill(); + } + if (lnPr.isSetSolidFill()) { + lnPr.unsetSolidFill(); + } + if (lnPr.isSetGradFill()) { + lnPr.unsetGradFill(); + } + if (lnPr.isSetPattFill()) { + lnPr.unsetPattFill(); + } + } else { + if (lnPr.isSetNoFill()) { + lnPr.unsetNoFill(); + } + + lnPr.setW(Units.toEMU(width)); + } + } + + /** + * @return line width in points. 0 means no line. + */ + public double getLineWidth() { + PropertyFetcher fetcher = new PropertyFetcher() { + public boolean fetch(XSLFShape shape) { + CTLineProperties ln = getLn(shape, false); + if (ln != null) { + if (ln.isSetNoFill()) { + setValue(0.); + return true; + } + + if (ln.isSetW()) { + setValue(Units.toPoints(ln.getW())); + return true; + } + } + return false; + } + }; + fetchShapeProperty(fetcher); + + double lineWidth = 0; + if (fetcher.getValue() == null) { + CTLineProperties defaultLn = getDefaultLineProperties(); + if (defaultLn != null) { + if (defaultLn.isSetW()) lineWidth = Units.toPoints(defaultLn.getW()); + } + } else { + lineWidth = fetcher.getValue(); + } + + return lineWidth; + } + + + /** + * @param compound set the line compound style + */ + public void setLineCompound(LineCompound compound) { + CTLineProperties ln = getLn(this, true); + if (ln == null) { + return; + } + if (compound == null) { + if (ln.isSetCmpd()) { + ln.unsetCmpd(); + } + } else { + STCompoundLine.Enum xCmpd; + switch (compound) { + default: + case SINGLE: + xCmpd = STCompoundLine.SNG; + break; + case DOUBLE: + xCmpd = STCompoundLine.DBL; + break; + case THICK_THIN: + xCmpd = STCompoundLine.THICK_THIN; + break; + case THIN_THICK: + xCmpd = STCompoundLine.THIN_THICK; + break; + case TRIPLE: + xCmpd = STCompoundLine.TRI; + break; + } + ln.setCmpd(xCmpd); + } + } + + /** + * @return the line compound + */ + public LineCompound getLineCompound() { + PropertyFetcher fetcher = new PropertyFetcher() { + public boolean fetch(XSLFShape shape) { + CTLineProperties ln = getLn(shape, false); + if (ln != null) { + STCompoundLine.Enum stCmpd = ln.getCmpd(); + if (stCmpd != null) { + setValue(stCmpd.intValue()); + return true; + } + } + return false; + } + }; + fetchShapeProperty(fetcher); + + Integer cmpd = fetcher.getValue(); + if (cmpd == null) { + CTLineProperties defaultLn = getDefaultLineProperties(); + if (defaultLn != null && defaultLn.isSetCmpd()) { + switch (defaultLn.getCmpd().intValue()) { + default: + case STCompoundLine.INT_SNG: + return LineCompound.SINGLE; + case STCompoundLine.INT_DBL: + return LineCompound.DOUBLE; + case STCompoundLine.INT_THICK_THIN: + return LineCompound.THICK_THIN; + case STCompoundLine.INT_THIN_THICK: + return LineCompound.THIN_THICK; + case STCompoundLine.INT_TRI: + return LineCompound.TRIPLE; + } + } + } + + return null; + } + + /** + * + * @param dash a preset line dashing scheme to stroke thr shape outline + */ + public void setLineDash(LineDash dash) { + CTLineProperties ln = getLn(this, true); + if (ln == null) { + return; + } + if (dash == null) { + if (ln.isSetPrstDash()) { + ln.unsetPrstDash(); + } + } else { + CTPresetLineDashProperties ldp = ln.isSetPrstDash() ? ln.getPrstDash() : ln.addNewPrstDash(); + ldp.setVal(STPresetLineDashVal.Enum.forInt(dash.ooxmlId)); + } + } + + /** + * @return a preset line dashing scheme to stroke the shape outline + */ + public LineDash getLineDash() { + + PropertyFetcher fetcher = new PropertyFetcher() { + public boolean fetch(XSLFShape shape) { + CTLineProperties ln = getLn(shape, false); + if (ln == null || !ln.isSetPrstDash()) { + return false; + } + + setValue(LineDash.fromOoxmlId(ln.getPrstDash().getVal().intValue())); + return true; + } + }; + fetchShapeProperty(fetcher); + + LineDash dash = fetcher.getValue(); + if (dash == null) { + CTLineProperties defaultLn = getDefaultLineProperties(); + if (defaultLn != null && defaultLn.isSetPrstDash()) { + dash = LineDash.fromOoxmlId(defaultLn.getPrstDash().getVal().intValue()); + } + } + return dash; + } + + /** + * + * @param cap the line end cap style + */ + public void setLineCap(LineCap cap) { + CTLineProperties ln = getLn(this, true); + if (ln == null) { + return; + } + + if (cap == null) { + if (ln.isSetCap()) { + ln.unsetCap(); + } + } else { + ln.setCap(STLineCap.Enum.forInt(cap.ooxmlId)); + } + } + + /** + * + * @return the line end cap style + */ + public LineCap getLineCap() { + PropertyFetcher fetcher = new PropertyFetcher() { + public boolean fetch(XSLFShape shape) { + CTLineProperties ln = getLn(shape, false); + if (ln != null && ln.isSetCap()) { + setValue(LineCap.fromOoxmlId(ln.getCap().intValue())); + return true; + } + return false; + } + }; + fetchShapeProperty(fetcher); + + LineCap cap = fetcher.getValue(); + if (cap == null) { + CTLineProperties defaultLn = getDefaultLineProperties(); + if (defaultLn != null && defaultLn.isSetCap()) { + cap = LineCap.fromOoxmlId(defaultLn.getCap().intValue()); + } + } + return cap; + } + + @Override + public void setFillColor(Color color) { + XSLFFillProperties fp = XSLFPropertiesDelegate.getFillDelegate(getShapeProperties()); + if (fp == null) { + return; + } + if (color == null) { + if (fp.isSetSolidFill()) { + fp.unsetSolidFill(); + } + + if (fp.isSetGradFill()) { + fp.unsetGradFill(); + } + + if (fp.isSetPattFill()) { + fp.unsetGradFill(); + } + + if (fp.isSetBlipFill()) { + fp.unsetBlipFill(); + } + + if (!fp.isSetNoFill()) { + fp.addNewNoFill(); + } + } else { + if (fp.isSetNoFill()) { + fp.unsetNoFill(); + } + + CTSolidColorFillProperties fill = fp.isSetSolidFill() ? fp.getSolidFill() : fp.addNewSolidFill(); + + XSLFColor col = new XSLFColor(fill, getSheet().getTheme(), fill.getSchemeClr()); + col.setColor(color); + } + } + + @Override + public Color getFillColor() { + PaintStyle ps = getFillPaint(); + if (ps instanceof SolidPaint) { + return DrawPaint.applyColorTransform(((SolidPaint)ps).getSolidColor()); + } + return null; + } + + /** + * @return shadow of this shape or null if shadow is disabled + */ + public XSLFShadow getShadow() { + PropertyFetcher fetcher = new PropertyFetcher() { + public boolean fetch(XSLFShape shape) { + XSLFEffectProperties ep = XSLFPropertiesDelegate.getEffectDelegate(shape.getShapeProperties()); + if (ep != null && ep.isSetEffectLst()) { + CTOuterShadowEffect obj = ep.getEffectLst().getOuterShdw(); + setValue(obj == null ? NO_SHADOW : obj); + return true; + } + return false; + } + }; + fetchShapeProperty(fetcher); + + CTOuterShadowEffect obj = fetcher.getValue(); + if (obj == null) { + // fill color was not found, check if it is defined in the theme + CTShapeStyle style = getSpStyle(); + if (style != null && style.getEffectRef() != null) { + // 1-based index of a shadow style within the style matrix + int idx = (int) style.getEffectRef().getIdx(); + if(idx != 0) { + CTStyleMatrix styleMatrix = getSheet().getTheme().getXmlObject().getThemeElements().getFmtScheme(); + CTEffectStyleItem ef = styleMatrix.getEffectStyleLst().getEffectStyleArray(idx - 1); + obj = ef.getEffectLst().getOuterShdw(); + } + } + } + return (obj == null || obj == NO_SHADOW) ? null : new XSLFShadow(obj, this); + } + + /** + * + * @return definition of the shape geometry + */ + public CustomGeometry getGeometry() { + XSLFGeometryProperties gp = XSLFPropertiesDelegate.getGeometryDelegate(getShapeProperties()); + + if (gp == null) { + return null; + } + + CustomGeometry geom; + PresetGeometries dict = PresetGeometries.getInstance(); + if(gp.isSetPrstGeom()){ + String name = gp.getPrstGeom().getPrst().toString(); + geom = dict.get(name); + if(geom == null) { + throw new IllegalStateException("Unknown shape geometry: " + name + ", available geometries are: " + dict.keySet()); + } + } else if (gp.isSetCustGeom()){ + XMLStreamReader staxReader = gp.getCustGeom().newXMLStreamReader(); + geom = PresetGeometries.convertCustomGeometry(staxReader); try { staxReader.close(); - } + } catch (XMLStreamException e) { LOG.log(POILogger.WARN, "An error occurred while closing a Custom Geometry XML Stream Reader: " + e.getMessage()); - } - } else { - geom = dict.get("rect"); - } - return geom; - } - - @Override - void copy(XSLFShape sh){ - super.copy(sh); - - XSLFSimpleShape s = (XSLFSimpleShape)sh; - - Color srsSolidFill = s.getFillColor(); - Color tgtSoliFill = getFillColor(); - if(srsSolidFill != null && !srsSolidFill.equals(tgtSoliFill)){ - setFillColor(srsSolidFill); - } - - XSLFFillProperties fp = XSLFPropertiesDelegate.getFillDelegate(getShapeProperties()); - if(fp != null && fp.isSetBlipFill()){ - CTBlip blip = fp.getBlipFill().getBlip(); - String blipId = blip.getEmbed(); - - String relId = getSheet().importBlip(blipId, s.getSheet().getPackagePart()); - blip.setEmbed(relId); - } - - Color srcLineColor = s.getLineColor(); - Color tgtLineColor = getLineColor(); - if(srcLineColor != null && !srcLineColor.equals(tgtLineColor)) { - setLineColor(srcLineColor); - } - - double srcLineWidth = s.getLineWidth(); - double tgtLineWidth = getLineWidth(); - if(srcLineWidth != tgtLineWidth) { - setLineWidth(srcLineWidth); - } - - LineDash srcLineDash = s.getLineDash(); - LineDash tgtLineDash = getLineDash(); - if(srcLineDash != null && srcLineDash != tgtLineDash) { - setLineDash(srcLineDash); - } - - LineCap srcLineCap = s.getLineCap(); - LineCap tgtLineCap = getLineCap(); - if(srcLineCap != null && srcLineCap != tgtLineCap) { - setLineCap(srcLineCap); - } - - } - - /** - * Specifies the line end decoration, such as a triangle or arrowhead. - * - * @param style the line end docoration style - */ - public void setLineHeadDecoration(DecorationShape style) { - CTLineProperties ln = getLn(this, true); - if (ln == null) { - return; - } - CTLineEndProperties lnEnd = ln.isSetHeadEnd() ? ln.getHeadEnd() : ln.addNewHeadEnd(); - if (style == null) { - if (lnEnd.isSetType()) { - lnEnd.unsetType(); - } - } else { - lnEnd.setType(STLineEndType.Enum.forInt(style.ooxmlId)); - } - } - - /** - * @return the line end decoration shape - */ - public DecorationShape getLineHeadDecoration() { - CTLineProperties ln = getLn(this, false); - DecorationShape ds = DecorationShape.NONE; - if (ln != null && ln.isSetHeadEnd() && ln.getHeadEnd().isSetType()) { - ds = DecorationShape.fromOoxmlId(ln.getHeadEnd().getType().intValue()); - } - return ds; - } - - /** - * specifies decoration width of the head of a line. - * - * @param style the decoration width - */ - public void setLineHeadWidth(DecorationSize style) { - CTLineProperties ln = getLn(this, true); - if (ln == null) { - return; - } - CTLineEndProperties lnEnd = ln.isSetHeadEnd() ? ln.getHeadEnd() : ln.addNewHeadEnd(); - if (style == null) { - if (lnEnd.isSetW()) { - lnEnd.unsetW(); - } - } else { - lnEnd.setW(STLineEndWidth.Enum.forInt(style.ooxmlId)); - } - } - - /** - * @return the line end decoration width - */ - public DecorationSize getLineHeadWidth() { - CTLineProperties ln = getLn(this, false); - DecorationSize ds = DecorationSize.MEDIUM; - if (ln != null && ln.isSetHeadEnd() && ln.getHeadEnd().isSetW()) { - ds = DecorationSize.fromOoxmlId(ln.getHeadEnd().getW().intValue()); - } - return ds; - } - - /** - * Specifies the line end width in relation to the line width. - */ - public void setLineHeadLength(DecorationSize style) { - CTLineProperties ln = getLn(this, true); - if (ln == null) { - return; - } - - CTLineEndProperties lnEnd = ln.isSetHeadEnd() ? ln.getHeadEnd() : ln.addNewHeadEnd(); - if (style == null) { - if (lnEnd.isSetLen()) { - lnEnd.unsetLen(); - } - } else { - lnEnd.setLen(STLineEndLength.Enum.forInt(style.ooxmlId)); - } - } - - /** - * @return the line end decoration length - */ - public DecorationSize getLineHeadLength() { - CTLineProperties ln = getLn(this, false); - - DecorationSize ds = DecorationSize.MEDIUM; - if (ln != null && ln.isSetHeadEnd() && ln.getHeadEnd().isSetLen()) { - ds = DecorationSize.fromOoxmlId(ln.getHeadEnd().getLen().intValue()); - } - return ds; - } - - /** - * Specifies the line end decoration, such as a triangle or arrowhead. - */ - public void setLineTailDecoration(DecorationShape style) { - CTLineProperties ln = getLn(this, true); - if (ln == null) { - return; - } - - CTLineEndProperties lnEnd = ln.isSetTailEnd() ? ln.getTailEnd() : ln.addNewTailEnd(); - if (style == null) { - if (lnEnd.isSetType()) { - lnEnd.unsetType(); - } - } else { - lnEnd.setType(STLineEndType.Enum.forInt(style.ooxmlId)); - } - } - - /** - * @return the line end decoration shape - */ - public DecorationShape getLineTailDecoration() { - CTLineProperties ln = getLn(this, false); - - DecorationShape ds = DecorationShape.NONE; - if (ln != null && ln.isSetTailEnd() && ln.getTailEnd().isSetType()) { - ds = DecorationShape.fromOoxmlId(ln.getTailEnd().getType().intValue()); - } - return ds; - } - - /** - * specifies decorations which can be added to the tail of a line. - */ - public void setLineTailWidth(DecorationSize style) { - CTLineProperties ln = getLn(this, true); - if (ln == null) { - return; - } - - CTLineEndProperties lnEnd = ln.isSetTailEnd() ? ln.getTailEnd() : ln.addNewTailEnd(); - if (style == null) { - if (lnEnd.isSetW()) { - lnEnd.unsetW(); - } - } else { - lnEnd.setW(STLineEndWidth.Enum.forInt(style.ooxmlId)); - } - } - - /** - * @return the line end decoration width - */ - public DecorationSize getLineTailWidth() { - CTLineProperties ln = getLn(this, false); - DecorationSize ds = DecorationSize.MEDIUM; - if (ln != null && ln.isSetTailEnd() && ln.getTailEnd().isSetW()) { - ds = DecorationSize.fromOoxmlId(ln.getTailEnd().getW().intValue()); - } - return ds; - } - - /** - * Specifies the line end width in relation to the line width. - */ - public void setLineTailLength(DecorationSize style) { - CTLineProperties ln = getLn(this, true); - if (ln == null) { - return; - } - - CTLineEndProperties lnEnd = ln.isSetTailEnd() ? ln.getTailEnd() : ln.addNewTailEnd(); - if (style == null) { - if (lnEnd.isSetLen()) { - lnEnd.unsetLen(); - } - } else { - lnEnd.setLen(STLineEndLength.Enum.forInt(style.ooxmlId)); - } - } - - /** - * @return the line end decoration length - */ - public DecorationSize getLineTailLength() { - CTLineProperties ln = getLn(this, false); - - DecorationSize ds = DecorationSize.MEDIUM; - if (ln != null && ln.isSetTailEnd() && ln.getTailEnd().isSetLen()) { - ds = DecorationSize.fromOoxmlId(ln.getTailEnd().getLen().intValue()); - } - return ds; - } - - public boolean isPlaceholder() { - CTPlaceholder ph = getCTPlaceholder(); - return ph != null; - } - - public Guide getAdjustValue(String name) { - XSLFGeometryProperties gp = XSLFPropertiesDelegate.getGeometryDelegate(getShapeProperties()); - - if (gp != null && gp.isSetPrstGeom() && gp.getPrstGeom().isSetAvLst()) { - for (CTGeomGuide g : gp.getPrstGeom().getAvLst().getGdArray()) { - if (g.getName().equals(name)) { - return new Guide(g.getName(), g.getFmla()); - } - } - } - - return null; - } - - public LineDecoration getLineDecoration() { - return new LineDecoration() { - public DecorationShape getHeadShape() { - return getLineHeadDecoration(); - } - - public DecorationSize getHeadWidth() { - return getLineHeadWidth(); - } - - public DecorationSize getHeadLength() { - return getLineHeadLength(); - } - - public DecorationShape getTailShape() { - return getLineTailDecoration(); - } - - public DecorationSize getTailWidth() { - return getLineTailWidth(); - } - - public DecorationSize getTailLength() { - return getLineTailLength(); - } - }; - } - - /** - * fetch shape fill as a java.awt.Paint - * - * @return either Color or GradientPaint or TexturePaint or null - */ - public FillStyle getFillStyle() { - return new FillStyle() { - public PaintStyle getPaint() { - return XSLFSimpleShape.this.getFillPaint(); - } - }; - } - - public StrokeStyle getStrokeStyle() { - return new StrokeStyle() { - public PaintStyle getPaint() { - return XSLFSimpleShape.this.getLinePaint(); - } - - public LineCap getLineCap() { - return XSLFSimpleShape.this.getLineCap(); - } - - public LineDash getLineDash() { - return XSLFSimpleShape.this.getLineDash(); - } - - public double getLineWidth() { - return XSLFSimpleShape.this.getLineWidth(); - } - - public LineCompound getLineCompound() { - return XSLFSimpleShape.this.getLineCompound(); - } - - }; - } - - @Override - public void setStrokeStyle(Object... styles) { - if (styles.length == 0) { - // remove stroke - setLineColor(null); - return; - } - - // TODO: handle PaintStyle - for (Object st : styles) { - if (st instanceof Number) { - setLineWidth(((Number)st).doubleValue()); - } else if (st instanceof LineCap) { - setLineCap((LineCap)st); - } else if (st instanceof LineDash) { - setLineDash((LineDash)st); - } else if (st instanceof LineCompound) { - setLineCompound((LineCompound)st); - } else if (st instanceof Color) { - setLineColor((Color)st); - } - } - } - - @Override - public void setPlaceholder(Placeholder placeholder) { - super.setPlaceholder(placeholder); - } - - @Override - public XSLFHyperlink getHyperlink() { - CTNonVisualDrawingProps cNvPr = getCNvPr(); - if (!cNvPr.isSetHlinkClick()) { - return null; - } - return new XSLFHyperlink(cNvPr.getHlinkClick(), getSheet()); - } - - @Override - public XSLFHyperlink createHyperlink() { - XSLFHyperlink hl = getHyperlink(); - if (hl == null) { - CTNonVisualDrawingProps cNvPr = getCNvPr(); - hl = new XSLFHyperlink(cNvPr.addNewHlinkClick(), getSheet()); - } - return hl; - } - - private static CTLineProperties getLn(XSLFShape shape, boolean create) { - XmlObject pr = shape.getShapeProperties(); - if (!(pr instanceof CTShapeProperties)) { - LOG.log(POILogger.WARN, shape.getClass().toString()+" doesn't have line properties"); - return null; - } - - CTShapeProperties spr = (CTShapeProperties)pr; - return (spr.isSetLn() || !create) ? spr.getLn() : spr.addNewLn(); - } + } + } else { + geom = dict.get("rect"); + } + return geom; + } + + @Override + void copy(XSLFShape sh){ + super.copy(sh); + + XSLFSimpleShape s = (XSLFSimpleShape)sh; + + Color srsSolidFill = s.getFillColor(); + Color tgtSoliFill = getFillColor(); + if(srsSolidFill != null && !srsSolidFill.equals(tgtSoliFill)){ + setFillColor(srsSolidFill); + } + + XSLFFillProperties fp = XSLFPropertiesDelegate.getFillDelegate(getShapeProperties()); + if(fp != null && fp.isSetBlipFill()){ + CTBlip blip = fp.getBlipFill().getBlip(); + String blipId = blip.getEmbed(); + + String relId = getSheet().importBlip(blipId, s.getSheet().getPackagePart()); + blip.setEmbed(relId); + } + + Color srcLineColor = s.getLineColor(); + Color tgtLineColor = getLineColor(); + if(srcLineColor != null && !srcLineColor.equals(tgtLineColor)) { + setLineColor(srcLineColor); + } + + double srcLineWidth = s.getLineWidth(); + double tgtLineWidth = getLineWidth(); + if(srcLineWidth != tgtLineWidth) { + setLineWidth(srcLineWidth); + } + + LineDash srcLineDash = s.getLineDash(); + LineDash tgtLineDash = getLineDash(); + if(srcLineDash != null && srcLineDash != tgtLineDash) { + setLineDash(srcLineDash); + } + + LineCap srcLineCap = s.getLineCap(); + LineCap tgtLineCap = getLineCap(); + if(srcLineCap != null && srcLineCap != tgtLineCap) { + setLineCap(srcLineCap); + } + + } + + /** + * Specifies the line end decoration, such as a triangle or arrowhead. + * + * @param style the line end docoration style + */ + public void setLineHeadDecoration(DecorationShape style) { + CTLineProperties ln = getLn(this, true); + if (ln == null) { + return; + } + CTLineEndProperties lnEnd = ln.isSetHeadEnd() ? ln.getHeadEnd() : ln.addNewHeadEnd(); + if (style == null) { + if (lnEnd.isSetType()) { + lnEnd.unsetType(); + } + } else { + lnEnd.setType(STLineEndType.Enum.forInt(style.ooxmlId)); + } + } + + /** + * @return the line end decoration shape + */ + public DecorationShape getLineHeadDecoration() { + CTLineProperties ln = getLn(this, false); + DecorationShape ds = DecorationShape.NONE; + if (ln != null && ln.isSetHeadEnd() && ln.getHeadEnd().isSetType()) { + ds = DecorationShape.fromOoxmlId(ln.getHeadEnd().getType().intValue()); + } + return ds; + } + + /** + * specifies decoration width of the head of a line. + * + * @param style the decoration width + */ + public void setLineHeadWidth(DecorationSize style) { + CTLineProperties ln = getLn(this, true); + if (ln == null) { + return; + } + CTLineEndProperties lnEnd = ln.isSetHeadEnd() ? ln.getHeadEnd() : ln.addNewHeadEnd(); + if (style == null) { + if (lnEnd.isSetW()) { + lnEnd.unsetW(); + } + } else { + lnEnd.setW(STLineEndWidth.Enum.forInt(style.ooxmlId)); + } + } + + /** + * @return the line end decoration width + */ + public DecorationSize getLineHeadWidth() { + CTLineProperties ln = getLn(this, false); + DecorationSize ds = DecorationSize.MEDIUM; + if (ln != null && ln.isSetHeadEnd() && ln.getHeadEnd().isSetW()) { + ds = DecorationSize.fromOoxmlId(ln.getHeadEnd().getW().intValue()); + } + return ds; + } + + /** + * Specifies the line end width in relation to the line width. + */ + public void setLineHeadLength(DecorationSize style) { + CTLineProperties ln = getLn(this, true); + if (ln == null) { + return; + } + + CTLineEndProperties lnEnd = ln.isSetHeadEnd() ? ln.getHeadEnd() : ln.addNewHeadEnd(); + if (style == null) { + if (lnEnd.isSetLen()) { + lnEnd.unsetLen(); + } + } else { + lnEnd.setLen(STLineEndLength.Enum.forInt(style.ooxmlId)); + } + } + + /** + * @return the line end decoration length + */ + public DecorationSize getLineHeadLength() { + CTLineProperties ln = getLn(this, false); + + DecorationSize ds = DecorationSize.MEDIUM; + if (ln != null && ln.isSetHeadEnd() && ln.getHeadEnd().isSetLen()) { + ds = DecorationSize.fromOoxmlId(ln.getHeadEnd().getLen().intValue()); + } + return ds; + } + + /** + * Specifies the line end decoration, such as a triangle or arrowhead. + */ + public void setLineTailDecoration(DecorationShape style) { + CTLineProperties ln = getLn(this, true); + if (ln == null) { + return; + } + + CTLineEndProperties lnEnd = ln.isSetTailEnd() ? ln.getTailEnd() : ln.addNewTailEnd(); + if (style == null) { + if (lnEnd.isSetType()) { + lnEnd.unsetType(); + } + } else { + lnEnd.setType(STLineEndType.Enum.forInt(style.ooxmlId)); + } + } + + /** + * @return the line end decoration shape + */ + public DecorationShape getLineTailDecoration() { + CTLineProperties ln = getLn(this, false); + + DecorationShape ds = DecorationShape.NONE; + if (ln != null && ln.isSetTailEnd() && ln.getTailEnd().isSetType()) { + ds = DecorationShape.fromOoxmlId(ln.getTailEnd().getType().intValue()); + } + return ds; + } + + /** + * specifies decorations which can be added to the tail of a line. + */ + public void setLineTailWidth(DecorationSize style) { + CTLineProperties ln = getLn(this, true); + if (ln == null) { + return; + } + + CTLineEndProperties lnEnd = ln.isSetTailEnd() ? ln.getTailEnd() : ln.addNewTailEnd(); + if (style == null) { + if (lnEnd.isSetW()) { + lnEnd.unsetW(); + } + } else { + lnEnd.setW(STLineEndWidth.Enum.forInt(style.ooxmlId)); + } + } + + /** + * @return the line end decoration width + */ + public DecorationSize getLineTailWidth() { + CTLineProperties ln = getLn(this, false); + DecorationSize ds = DecorationSize.MEDIUM; + if (ln != null && ln.isSetTailEnd() && ln.getTailEnd().isSetW()) { + ds = DecorationSize.fromOoxmlId(ln.getTailEnd().getW().intValue()); + } + return ds; + } + + /** + * Specifies the line end width in relation to the line width. + */ + public void setLineTailLength(DecorationSize style) { + CTLineProperties ln = getLn(this, true); + if (ln == null) { + return; + } + + CTLineEndProperties lnEnd = ln.isSetTailEnd() ? ln.getTailEnd() : ln.addNewTailEnd(); + if (style == null) { + if (lnEnd.isSetLen()) { + lnEnd.unsetLen(); + } + } else { + lnEnd.setLen(STLineEndLength.Enum.forInt(style.ooxmlId)); + } + } + + /** + * @return the line end decoration length + */ + public DecorationSize getLineTailLength() { + CTLineProperties ln = getLn(this, false); + + DecorationSize ds = DecorationSize.MEDIUM; + if (ln != null && ln.isSetTailEnd() && ln.getTailEnd().isSetLen()) { + ds = DecorationSize.fromOoxmlId(ln.getTailEnd().getLen().intValue()); + } + return ds; + } + + public boolean isPlaceholder() { + CTPlaceholder ph = getCTPlaceholder(); + return ph != null; + } + + public Guide getAdjustValue(String name) { + XSLFGeometryProperties gp = XSLFPropertiesDelegate.getGeometryDelegate(getShapeProperties()); + + if (gp != null && gp.isSetPrstGeom() && gp.getPrstGeom().isSetAvLst()) { + for (CTGeomGuide g : gp.getPrstGeom().getAvLst().getGdArray()) { + if (g.getName().equals(name)) { + return new Guide(g.getName(), g.getFmla()); + } + } + } + + return null; + } + + public LineDecoration getLineDecoration() { + return new LineDecoration() { + public DecorationShape getHeadShape() { + return getLineHeadDecoration(); + } + + public DecorationSize getHeadWidth() { + return getLineHeadWidth(); + } + + public DecorationSize getHeadLength() { + return getLineHeadLength(); + } + + public DecorationShape getTailShape() { + return getLineTailDecoration(); + } + + public DecorationSize getTailWidth() { + return getLineTailWidth(); + } + + public DecorationSize getTailLength() { + return getLineTailLength(); + } + }; + } + + /** + * fetch shape fill as a java.awt.Paint + * + * @return either Color or GradientPaint or TexturePaint or null + */ + public FillStyle getFillStyle() { + return new FillStyle() { + public PaintStyle getPaint() { + return XSLFSimpleShape.this.getFillPaint(); + } + }; + } + + public StrokeStyle getStrokeStyle() { + return new StrokeStyle() { + public PaintStyle getPaint() { + return XSLFSimpleShape.this.getLinePaint(); + } + + public LineCap getLineCap() { + return XSLFSimpleShape.this.getLineCap(); + } + + public LineDash getLineDash() { + return XSLFSimpleShape.this.getLineDash(); + } + + public double getLineWidth() { + return XSLFSimpleShape.this.getLineWidth(); + } + + public LineCompound getLineCompound() { + return XSLFSimpleShape.this.getLineCompound(); + } + + }; + } + + @Override + public void setStrokeStyle(Object... styles) { + if (styles.length == 0) { + // remove stroke + setLineColor(null); + return; + } + + // TODO: handle PaintStyle + for (Object st : styles) { + if (st instanceof Number) { + setLineWidth(((Number)st).doubleValue()); + } else if (st instanceof LineCap) { + setLineCap((LineCap)st); + } else if (st instanceof LineDash) { + setLineDash((LineDash)st); + } else if (st instanceof LineCompound) { + setLineCompound((LineCompound)st); + } else if (st instanceof Color) { + setLineColor((Color)st); + } + } + } + + @Override + public void setPlaceholder(Placeholder placeholder) { + super.setPlaceholder(placeholder); + } + + @Override + public XSLFHyperlink getHyperlink() { + CTNonVisualDrawingProps cNvPr = getCNvPr(); + if (!cNvPr.isSetHlinkClick()) { + return null; + } + return new XSLFHyperlink(cNvPr.getHlinkClick(), getSheet()); + } + + @Override + public XSLFHyperlink createHyperlink() { + XSLFHyperlink hl = getHyperlink(); + if (hl == null) { + CTNonVisualDrawingProps cNvPr = getCNvPr(); + hl = new XSLFHyperlink(cNvPr.addNewHlinkClick(), getSheet()); + } + return hl; + } + + private static CTLineProperties getLn(XSLFShape shape, boolean create) { + XmlObject pr = shape.getShapeProperties(); + if (!(pr instanceof CTShapeProperties)) { + LOG.log(POILogger.WARN, shape.getClass().toString()+" doesn't have line properties"); + return null; + } + + CTShapeProperties spr = (CTShapeProperties)pr; + return (spr.isSetLn() || !create) ? spr.getLn() : spr.addNewLn(); + } }